C10H15N3S — CID 131160596
[6-bicyclo[3.1.0]hexanyl(1,2-thiazol-3-yl)methyl]hydrazine (PubChem CID 131160596) has the molecular formula C10H15N3S and a molecular weight of 209.32 g/mol. Its IUPAC name is [6-bicyclo[3.1.0]hexanyl(1,2-thiazol-3-yl)methyl]hydrazine.
| Compound Name | [6-bicyclo[3.1.0]hexanyl(1,2-thiazol-3-yl)methyl]hydrazine |
|---|---|
| PubChem CID | 131160596 |
| Molecular Formula | C10H15N3S |
| Molecular Weight | 209.32 g/mol |
| Exact Mass | 209.10 |
| IUPAC Name | [6-bicyclo[3.1.0]hexanyl(1,2-thiazol-3-yl)methyl]hydrazine |
| SMILES | NNC(c1ccsn1)C1C2CCCC21 |
| InChI | InChI=1S/C10H15N3S/c11-12-10(8-4-5-14-13-8)9-6-2-1-3-7(6)9/h4-7,9-10,12H,1-3,11H2 |
| InChIKey | VGZBDYBLKDYFII-UHFFFAOYSA-N |
| XLogP | 1.69 |
| TPSA | 50.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.32 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|