C15H19F3N2 — CID 105302349
[7-bicyclo[4.1.0]heptanyl-[4-(trifluoromethyl)phenyl]methyl]hydrazine (PubChem CID 105302349) has the molecular formula C15H19F3N2 and a molecular weight of 284.32 g/mol. Its IUPAC name is [7-bicyclo[4.1.0]heptanyl-[4-(trifluoromethyl)phenyl]methyl]hydrazine.
| Compound Name | [7-bicyclo[4.1.0]heptanyl-[4-(trifluoromethyl)phenyl]methyl]hydrazine |
|---|---|
| PubChem CID | 105302349 |
| Molecular Formula | C15H19F3N2 |
| Molecular Weight | 284.32 g/mol |
| Exact Mass | 284.15 |
| IUPAC Name | [7-bicyclo[4.1.0]heptanyl-[4-(trifluoromethyl)phenyl]methyl]hydrazine |
| SMILES | NNC(c1ccc(C(F)(F)F)cc1)C1C2CCCCC21 |
| InChI | InChI=1S/C15H19F3N2/c16-15(17,18)10-7-5-9(6-8-10)14(20-19)13-11-3-1-2-4-12(11)13/h5-8,11-14,20H,1-4,19H2 |
| InChIKey | BXIDVAVNWQTDHM-UHFFFAOYSA-N |
| XLogP | 3.65 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.32 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|