C17H20N2 — CID 105301264
[6-bicyclo[3.1.0]hexanyl(naphthalen-1-yl)methyl]hydrazine (PubChem CID 105301264) has the molecular formula C17H20N2 and a molecular weight of 252.36 g/mol. Its IUPAC name is [6-bicyclo[3.1.0]hexanyl(naphthalen-1-yl)methyl]hydrazine.
| Compound Name | [6-bicyclo[3.1.0]hexanyl(naphthalen-1-yl)methyl]hydrazine |
|---|---|
| PubChem CID | 105301264 |
| Molecular Formula | C17H20N2 |
| Molecular Weight | 252.36 g/mol |
| Exact Mass | 252.16 |
| IUPAC Name | [6-bicyclo[3.1.0]hexanyl(naphthalen-1-yl)methyl]hydrazine |
| SMILES | NNC(c1cccc2ccccc12)C1C2CCCC21 |
| InChI | InChI=1S/C17H20N2/c18-19-17(16-13-8-4-9-14(13)16)15-10-3-6-11-5-1-2-7-12(11)15/h1-3,5-7,10,13-14,16-17,19H,4,8-9,18H2 |
| InChIKey | HZMUTPOBDLXFGU-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.36 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|