C8H12N2S2 — CID 130640950
1,2-thiazol-3-yl(thiolan-2-yl)methanamine (PubChem CID 130640950) has the molecular formula C8H12N2S2 and a molecular weight of 200.33 g/mol. Its IUPAC name is 1,2-thiazol-3-yl(thiolan-2-yl)methanamine.
| Compound Name | 1,2-thiazol-3-yl(thiolan-2-yl)methanamine |
|---|---|
| PubChem CID | 130640950 |
| Molecular Formula | C8H12N2S2 |
| Molecular Weight | 200.33 g/mol |
| Exact Mass | 200.04 |
| IUPAC Name | 1,2-thiazol-3-yl(thiolan-2-yl)methanamine |
| SMILES | NC(c1ccsn1)C1CCCS1 |
| InChI | InChI=1S/C8H12N2S2/c9-8(6-3-5-12-10-6)7-2-1-4-11-7/h3,5,7-8H,1-2,4,9H2 |
| InChIKey | VVFWPSQHXJRUSY-UHFFFAOYSA-N |
| XLogP | 2.04 |
| TPSA | 38.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 200.33 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |