C15H17NS — CID 80623183
naphthalen-2-yl(thiolan-2-yl)methanamine (PubChem CID 80623183) has the molecular formula C15H17NS and a molecular weight of 243.38 g/mol. Its IUPAC name is naphthalen-2-yl(thiolan-2-yl)methanamine.
| Compound Name | naphthalen-2-yl(thiolan-2-yl)methanamine |
|---|---|
| PubChem CID | 80623183 |
| Molecular Formula | C15H17NS |
| Molecular Weight | 243.38 g/mol |
| Exact Mass | 243.11 |
| IUPAC Name | naphthalen-2-yl(thiolan-2-yl)methanamine |
| SMILES | NC(c1ccc2ccccc2c1)C1CCCS1 |
| InChI | InChI=1S/C15H17NS/c16-15(14-6-3-9-17-14)13-8-7-11-4-1-2-5-12(11)10-13/h1-2,4-5,7-8,10,14-15H,3,6,9,16H2 |
| InChIKey | XCUBEIWCLGTDLR-UHFFFAOYSA-N |
| XLogP | 3.74 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.38 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |