C11H18N2S — CID 131017327
2-cyclohexyl-1-(1,2-thiazol-3-yl)ethanamine (PubChem CID 131017327) has the molecular formula C11H18N2S and a molecular weight of 210.35 g/mol. Its IUPAC name is 2-cyclohexyl-1-(1,2-thiazol-3-yl)ethanamine.
| Compound Name | 2-cyclohexyl-1-(1,2-thiazol-3-yl)ethanamine |
|---|---|
| PubChem CID | 131017327 |
| Molecular Formula | C11H18N2S |
| Molecular Weight | 210.35 g/mol |
| Exact Mass | 210.12 |
| IUPAC Name | 2-cyclohexyl-1-(1,2-thiazol-3-yl)ethanamine |
| SMILES | NC(CC1CCCCC1)c1ccsn1 |
| InChI | InChI=1S/C11H18N2S/c12-10(11-6-7-14-13-11)8-9-4-2-1-3-5-9/h6-7,9-10H,1-5,8,12H2 |
| InChIKey | PMPGVMSHXUWQEV-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 38.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.35 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |