C9H15N3OS — CID 130604837
[(2-methyloxolan-3-yl)-(1,2-thiazol-3-yl)methyl]hydrazine (PubChem CID 130604837) has the molecular formula C9H15N3OS and a molecular weight of 213.31 g/mol. Its IUPAC name is [(2-methyloxolan-3-yl)-(1,2-thiazol-3-yl)methyl]hydrazine.
| Compound Name | [(2-methyloxolan-3-yl)-(1,2-thiazol-3-yl)methyl]hydrazine |
|---|---|
| PubChem CID | 130604837 |
| Molecular Formula | C9H15N3OS |
| Molecular Weight | 213.31 g/mol |
| Exact Mass | 213.09 |
| IUPAC Name | [(2-methyloxolan-3-yl)-(1,2-thiazol-3-yl)methyl]hydrazine |
| SMILES | CC1OCCC1C(NN)c1ccsn1 |
| InChI | InChI=1S/C9H15N3OS/c1-6-7(2-4-13-6)9(11-10)8-3-5-14-12-8/h3,5-7,9,11H,2,4,10H2,1H3 |
| InChIKey | VELKUVMLSPOVKW-UHFFFAOYSA-N |
| XLogP | 1.07 |
| TPSA | 60.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 213.31 |
| LogP ≤ 5 | 1.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|