C10H7N3O — CID 103123919
1-pyrazolo[1,5-a]pyrazin-3-ylbut-3-yn-1-one (PubChem CID 103123919) has the molecular formula C10H7N3O and a molecular weight of 185.19 g/mol. Its IUPAC name is 1-pyrazolo[1,5-a]pyrazin-3-ylbut-3-yn-1-one.
| Compound Name | 1-pyrazolo[1,5-a]pyrazin-3-ylbut-3-yn-1-one |
|---|---|
| PubChem CID | 103123919 |
| Molecular Formula | C10H7N3O |
| Molecular Weight | 185.19 g/mol |
| Exact Mass | 185.06 |
| IUPAC Name | 1-pyrazolo[1,5-a]pyrazin-3-ylbut-3-yn-1-one |
| SMILES | C#CCC(=O)c1cnn2ccncc12 |
| InChI | InChI=1S/C10H7N3O/c1-2-3-10(14)8-6-12-13-5-4-11-7-9(8)13/h1,4-7H,3H2 |
| InChIKey | LQHRAPQXTBRPEV-UHFFFAOYSA-N |
| XLogP | 0.94 |
| TPSA | 47.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 185.19 |
| LogP ≤ 5 | 0.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|