C14H9Cl2N3O — CID 107311523
2-(2,3-dichlorophenyl)-1-pyrazolo[1,5-a]pyrazin-3-ylethanone (PubChem CID 107311523) has the molecular formula C14H9Cl2N3O and a molecular weight of 306.15 g/mol. Its IUPAC name is 2-(2,3-dichlorophenyl)-1-pyrazolo[1,5-a]pyrazin-3-ylethanone.
| Compound Name | 2-(2,3-dichlorophenyl)-1-pyrazolo[1,5-a]pyrazin-3-ylethanone |
|---|---|
| PubChem CID | 107311523 |
| Molecular Formula | C14H9Cl2N3O |
| Molecular Weight | 306.15 g/mol |
| Exact Mass | 305.01 |
| IUPAC Name | 2-(2,3-dichlorophenyl)-1-pyrazolo[1,5-a]pyrazin-3-ylethanone |
| SMILES | O=C(Cc1cccc(Cl)c1Cl)c1cnn2ccncc12 |
| InChI | InChI=1S/C14H9Cl2N3O/c15-11-3-1-2-9(14(11)16)6-13(20)10-7-18-19-5-4-17-8-12(10)19/h1-5,7-8H,6H2 |
| InChIKey | CIVPRCUHHFTVBD-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 47.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.15 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |