C13H8Cl2FNO — CID 107307992
2-(2,3-dichlorophenyl)-1-(3-fluoro-4-pyridinyl)ethanone (PubChem CID 107307992) has the molecular formula C13H8Cl2FNO and a molecular weight of 284.12 g/mol. Its IUPAC name is 2-(2,3-dichlorophenyl)-1-(3-fluoro-4-pyridinyl)ethanone.
| Compound Name | 2-(2,3-dichlorophenyl)-1-(3-fluoro-4-pyridinyl)ethanone |
|---|---|
| PubChem CID | 107307992 |
| Molecular Formula | C13H8Cl2FNO |
| Molecular Weight | 284.12 g/mol |
| Exact Mass | 283.00 |
| IUPAC Name | 2-(2,3-dichlorophenyl)-1-(3-fluoro-4-pyridinyl)ethanone |
| SMILES | O=C(Cc1cccc(Cl)c1Cl)c1ccncc1F |
| InChI | InChI=1S/C13H8Cl2FNO/c14-10-3-1-2-8(13(10)15)6-12(18)9-4-5-17-7-11(9)16/h1-5,7H,6H2 |
| InChIKey | QEIBUJJEQXAOTA-UHFFFAOYSA-N |
| XLogP | 3.95 |
| TPSA | 29.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.12 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |