C13H7Cl2F2NO — CID 112655306
1-(4-chloro-2,5-difluorophenyl)-2-(3-chloro-4-pyridinyl)ethanone (PubChem CID 112655306) has the molecular formula C13H7Cl2F2NO and a molecular weight of 302.11 g/mol. Its IUPAC name is 1-(4-chloro-2,5-difluorophenyl)-2-(3-chloro-4-pyridinyl)ethanone.
| Compound Name | 1-(4-chloro-2,5-difluorophenyl)-2-(3-chloro-4-pyridinyl)ethanone |
|---|---|
| PubChem CID | 112655306 |
| Molecular Formula | C13H7Cl2F2NO |
| Molecular Weight | 302.11 g/mol |
| Exact Mass | 300.99 |
| IUPAC Name | 1-(4-chloro-2,5-difluorophenyl)-2-(3-chloro-4-pyridinyl)ethanone |
| SMILES | O=C(Cc1ccncc1Cl)c1cc(F)c(Cl)cc1F |
| InChI | InChI=1S/C13H7Cl2F2NO/c14-9-5-11(16)8(4-12(9)17)13(19)3-7-1-2-18-6-10(7)15/h1-2,4-6H,3H2 |
| InChIKey | UPTDGYBNJLMOFQ-UHFFFAOYSA-N |
| XLogP | 4.09 |
| TPSA | 29.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.11 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|