C14H8BrClF2O — CID 82771447
2-(4-bromophenyl)-1-(4-chloro-2,5-difluorophenyl)ethanone (PubChem CID 82771447) has the molecular formula C14H8BrClF2O and a molecular weight of 345.57 g/mol. Its IUPAC name is 2-(4-bromophenyl)-1-(4-chloro-2,5-difluorophenyl)ethanone.
| Compound Name | 2-(4-bromophenyl)-1-(4-chloro-2,5-difluorophenyl)ethanone |
|---|---|
| PubChem CID | 82771447 |
| Molecular Formula | C14H8BrClF2O |
| Molecular Weight | 345.57 g/mol |
| Exact Mass | 343.94 |
| IUPAC Name | 2-(4-bromophenyl)-1-(4-chloro-2,5-difluorophenyl)ethanone |
| SMILES | O=C(Cc1ccc(Br)cc1)c1cc(F)c(Cl)cc1F |
| InChI | InChI=1S/C14H8BrClF2O/c15-9-3-1-8(2-4-9)5-14(19)10-6-13(18)11(16)7-12(10)17/h1-4,6-7H,5H2 |
| InChIKey | XTVVDMFFTNYENV-UHFFFAOYSA-N |
| XLogP | 4.81 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.57 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|