C15H11ClF2O2 — CID 82772175
1-(4-chloro-2,5-difluorophenyl)-2-(3-methoxyphenyl)ethanone (PubChem CID 82772175) has the molecular formula C15H11ClF2O2 and a molecular weight of 296.70 g/mol. Its IUPAC name is 1-(4-chloro-2,5-difluorophenyl)-2-(3-methoxyphenyl)ethanone.
| Compound Name | 1-(4-chloro-2,5-difluorophenyl)-2-(3-methoxyphenyl)ethanone |
|---|---|
| PubChem CID | 82772175 |
| Molecular Formula | C15H11ClF2O2 |
| Molecular Weight | 296.70 g/mol |
| Exact Mass | 296.04 |
| IUPAC Name | 1-(4-chloro-2,5-difluorophenyl)-2-(3-methoxyphenyl)ethanone |
| SMILES | COc1cccc(CC(=O)c2cc(F)c(Cl)cc2F)c1 |
| InChI | InChI=1S/C15H11ClF2O2/c1-20-10-4-2-3-9(5-10)6-15(19)11-7-14(18)12(16)8-13(11)17/h2-5,7-8H,6H2,1H3 |
| InChIKey | IYARRXLBINIPOP-UHFFFAOYSA-N |
| XLogP | 4.05 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.70 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|