C15H10ClF3O2 — CID 114966239
1-(4-chloro-2,5-difluorophenyl)-2-(3-fluoro-4-methoxyphenyl)ethanone (PubChem CID 114966239) has the molecular formula C15H10ClF3O2 and a molecular weight of 314.69 g/mol. Its IUPAC name is 1-(4-chloro-2,5-difluorophenyl)-2-(3-fluoro-4-methoxyphenyl)ethanone.
| Compound Name | 1-(4-chloro-2,5-difluorophenyl)-2-(3-fluoro-4-methoxyphenyl)ethanone |
|---|---|
| PubChem CID | 114966239 |
| Molecular Formula | C15H10ClF3O2 |
| Molecular Weight | 314.69 g/mol |
| Exact Mass | 314.03 |
| IUPAC Name | 1-(4-chloro-2,5-difluorophenyl)-2-(3-fluoro-4-methoxyphenyl)ethanone |
| SMILES | COc1ccc(CC(=O)c2cc(F)c(Cl)cc2F)cc1F |
| InChI | InChI=1S/C15H10ClF3O2/c1-21-15-3-2-8(4-13(15)19)5-14(20)9-6-12(18)10(16)7-11(9)17/h2-4,6-7H,5H2,1H3 |
| InChIKey | MNBOITDBASOZEH-UHFFFAOYSA-N |
| XLogP | 4.19 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.69 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|