C16H15N3O — CID 103124015
2-(2,5-dimethylphenyl)-1-pyrazolo[1,5-a]pyrazin-3-ylethanone (PubChem CID 103124015) has the molecular formula C16H15N3O and a molecular weight of 265.32 g/mol. Its IUPAC name is 2-(2,5-dimethylphenyl)-1-pyrazolo[1,5-a]pyrazin-3-ylethanone.
| Compound Name | 2-(2,5-dimethylphenyl)-1-pyrazolo[1,5-a]pyrazin-3-ylethanone |
|---|---|
| PubChem CID | 103124015 |
| Molecular Formula | C16H15N3O |
| Molecular Weight | 265.32 g/mol |
| Exact Mass | 265.12 |
| IUPAC Name | 2-(2,5-dimethylphenyl)-1-pyrazolo[1,5-a]pyrazin-3-ylethanone |
| SMILES | Cc1ccc(C)c(CC(=O)c2cnn3ccncc23)c1 |
| InChI | InChI=1S/C16H15N3O/c1-11-3-4-12(2)13(7-11)8-16(20)14-9-18-19-6-5-17-10-15(14)19/h3-7,9-10H,8H2,1-2H3 |
| InChIKey | MVXZDFHLAZMTNN-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 47.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.32 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |