C13H10N4O2S — CID 103119514
1-(2-methyl-1,3-thiazol-4-yl)-3-pyrazolo[1,5-a]pyrazin-3-ylpropane-1,3-dione (PubChem CID 103119514) has the molecular formula C13H10N4O2S and a molecular weight of 286.32 g/mol. Its IUPAC name is 1-(2-methyl-1,3-thiazol-4-yl)-3-pyrazolo[1,5-a]pyrazin-3-ylpropane-1,3-dione.
| Compound Name | 1-(2-methyl-1,3-thiazol-4-yl)-3-pyrazolo[1,5-a]pyrazin-3-ylpropane-1,3-dione |
|---|---|
| PubChem CID | 103119514 |
| Molecular Formula | C13H10N4O2S |
| Molecular Weight | 286.32 g/mol |
| Exact Mass | 286.05 |
| IUPAC Name | 1-(2-methyl-1,3-thiazol-4-yl)-3-pyrazolo[1,5-a]pyrazin-3-ylpropane-1,3-dione |
| SMILES | Cc1nc(C(=O)CC(=O)c2cnn3ccncc23)cs1 |
| InChI | InChI=1S/C13H10N4O2S/c1-8-16-10(7-20-8)13(19)4-12(18)9-5-15-17-3-2-14-6-11(9)17/h2-3,5-7H,4H2,1H3 |
| InChIKey | UCLBAXVSOJRVFO-UHFFFAOYSA-N |
| XLogP | 1.95 |
| TPSA | 77.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.32 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|