C8H9NO3S — CID 82658265
methyl 3-(2-methyl-1,3-thiazol-4-yl)-3-oxopropanoate (PubChem CID 82658265) has the molecular formula C8H9NO3S and a molecular weight of 199.23 g/mol. Its IUPAC name is methyl 3-(2-methyl-1,3-thiazol-4-yl)-3-oxopropanoate.
| Compound Name | methyl 3-(2-methyl-1,3-thiazol-4-yl)-3-oxopropanoate |
|---|---|
| PubChem CID | 82658265 |
| Molecular Formula | C8H9NO3S |
| Molecular Weight | 199.23 g/mol |
| Exact Mass | 199.03 |
| IUPAC Name | methyl 3-(2-methyl-1,3-thiazol-4-yl)-3-oxopropanoate |
| SMILES | COC(=O)CC(=O)c1csc(C)n1 |
| InChI | InChI=1S/C8H9NO3S/c1-5-9-6(4-13-5)7(10)3-8(11)12-2/h4H,3H2,1-2H3 |
| InChIKey | CHQKFKRIPZMDRY-UHFFFAOYSA-N |
| XLogP | 1.20 |
| TPSA | 56.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 199.23 |
| LogP ≤ 5 | 1.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|