About 3-(2-methyl-1,3-thiazol-4-yl)-3-oxopropanenitrile
3-(2-methyl-1,3-thiazol-4-yl)-3-oxopropanenitrile (PubChem CID 82414227) has the molecular formula C7H6N2OS
and a molecular weight of 166.20 g/mol. Its IUPAC name is 3-(2-methyl-1,3-thiazol-4-yl)-3-oxopropanenitrile.
Analyze 3-(2-methyl-1,3-thiazol-4-yl)-3-oxopropanenitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(2-methyl-1,3-thiazol-4-yl)-3-oxopropanenitrile?
The IUPAC name of 3-(2-methyl-1,3-thiazol-4-yl)-3-oxopropanenitrile (CID 82414227) is 3-(2-methyl-1,3-thiazol-4-yl)-3-oxopropanenitrile.
What is the SMILES notation for 3-(2-methyl-1,3-thiazol-4-yl)-3-oxopropanenitrile?
The canonical SMILES for 3-(2-methyl-1,3-thiazol-4-yl)-3-oxopropanenitrile is Cc1nc(C(=O)CC#N)cs1.
What is the InChIKey of 3-(2-methyl-1,3-thiazol-4-yl)-3-oxopropanenitrile?
The InChIKey is TXIHSWUVJDVSPF-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H6N2OS/c1-5-9-6(4-11-5)7(10)2-3-8/h4H,2H2,1H3.
What are the key properties of 3-(2-methyl-1,3-thiazol-4-yl)-3-oxopropanenitrile?
3-(2-methyl-1,3-thiazol-4-yl)-3-oxopropanenitrile has a molecular weight of 166.20 g/mol, XLogP of 1.55, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(2-methyl-1,3-thiazol-4-yl)-3-oxopropanenitrile is sourced from PubChem (CID 82414227), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).