C10H13N3OS — CID 65199875
N-(cyanomethyl)-2-methyl-N-propan-2-yl-1,3-thiazole-4-carboxamide (PubChem CID 65199875) has the molecular formula C10H13N3OS and a molecular weight of 223.30 g/mol. Its IUPAC name is N-(cyanomethyl)-2-methyl-N-propan-2-yl-1,3-thiazole-4-carboxamide.
| Compound Name | N-(cyanomethyl)-2-methyl-N-propan-2-yl-1,3-thiazole-4-carboxamide |
|---|---|
| PubChem CID | 65199875 |
| Molecular Formula | C10H13N3OS |
| Molecular Weight | 223.30 g/mol |
| Exact Mass | 223.08 |
| IUPAC Name | N-(cyanomethyl)-2-methyl-N-propan-2-yl-1,3-thiazole-4-carboxamide |
| SMILES | Cc1nc(C(=O)N(CC#N)C(C)C)cs1 |
| InChI | InChI=1S/C10H13N3OS/c1-7(2)13(5-4-11)10(14)9-6-15-8(3)12-9/h6-7H,5H2,1-3H3 |
| InChIKey | METFFAYUOFNYCV-UHFFFAOYSA-N |
| XLogP | 1.83 |
| TPSA | 56.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.30 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'cyanamide', 'substructure': 'N/A'} |
|---|