C12H19ClN2OS — CID 65198386
N-(2-chloroethyl)-2-methyl-N-pentan-3-yl-1,3-thiazole-4-carboxamide (PubChem CID 65198386) has the molecular formula C12H19ClN2OS and a molecular weight of 274.82 g/mol. Its IUPAC name is N-(2-chloroethyl)-2-methyl-N-pentan-3-yl-1,3-thiazole-4-carboxamide.
| Compound Name | N-(2-chloroethyl)-2-methyl-N-pentan-3-yl-1,3-thiazole-4-carboxamide |
|---|---|
| PubChem CID | 65198386 |
| Molecular Formula | C12H19ClN2OS |
| Molecular Weight | 274.82 g/mol |
| Exact Mass | 274.09 |
| IUPAC Name | N-(2-chloroethyl)-2-methyl-N-pentan-3-yl-1,3-thiazole-4-carboxamide |
| SMILES | CCC(CC)N(CCCl)C(=O)c1csc(C)n1 |
| InChI | InChI=1S/C12H19ClN2OS/c1-4-10(5-2)15(7-6-13)12(16)11-8-17-9(3)14-11/h8,10H,4-7H2,1-3H3 |
| InChIKey | KEPSWGJDGWQSDL-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 33.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.82 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|