C13H19ClN2OS — CID 65198822
N-(2-chloroethyl)-N-cyclohexyl-2-methyl-1,3-thiazole-4-carboxamide (PubChem CID 65198822) has the molecular formula C13H19ClN2OS and a molecular weight of 286.83 g/mol. Its IUPAC name is N-(2-chloroethyl)-N-cyclohexyl-2-methyl-1,3-thiazole-4-carboxamide.
| Compound Name | N-(2-chloroethyl)-N-cyclohexyl-2-methyl-1,3-thiazole-4-carboxamide |
|---|---|
| PubChem CID | 65198822 |
| Molecular Formula | C13H19ClN2OS |
| Molecular Weight | 286.83 g/mol |
| Exact Mass | 286.09 |
| IUPAC Name | N-(2-chloroethyl)-N-cyclohexyl-2-methyl-1,3-thiazole-4-carboxamide |
| SMILES | Cc1nc(C(=O)N(CCCl)C2CCCCC2)cs1 |
| InChI | InChI=1S/C13H19ClN2OS/c1-10-15-12(9-18-10)13(17)16(8-7-14)11-5-3-2-4-6-11/h9,11H,2-8H2,1H3 |
| InChIKey | IWEVSPHLILISCB-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 33.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.83 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|