C11H17ClN2OS — CID 65198714
N-butyl-N-(2-chloroethyl)-2-methyl-1,3-thiazole-4-carboxamide (PubChem CID 65198714) has the molecular formula C11H17ClN2OS and a molecular weight of 260.79 g/mol. Its IUPAC name is N-butyl-N-(2-chloroethyl)-2-methyl-1,3-thiazole-4-carboxamide.
| Compound Name | N-butyl-N-(2-chloroethyl)-2-methyl-1,3-thiazole-4-carboxamide |
|---|---|
| PubChem CID | 65198714 |
| Molecular Formula | C11H17ClN2OS |
| Molecular Weight | 260.79 g/mol |
| Exact Mass | 260.08 |
| IUPAC Name | N-butyl-N-(2-chloroethyl)-2-methyl-1,3-thiazole-4-carboxamide |
| SMILES | CCCCN(CCCl)C(=O)c1csc(C)n1 |
| InChI | InChI=1S/C11H17ClN2OS/c1-3-4-6-14(7-5-12)11(15)10-8-16-9(2)13-10/h8H,3-7H2,1-2H3 |
| InChIKey | GOXCPTPCAZTYEP-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 33.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.79 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|