About 2-hydroxy-1-(2-methyl-1,3-thiazol-4-yl)propan-1-one
2-hydroxy-1-(2-methyl-1,3-thiazol-4-yl)propan-1-one (PubChem CID 130906323) has the molecular formula C7H9NO2S
and a molecular weight of 171.22 g/mol. Its IUPAC name is 2-hydroxy-1-(2-methyl-1,3-thiazol-4-yl)propan-1-one.
Analyze 2-hydroxy-1-(2-methyl-1,3-thiazol-4-yl)propan-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-hydroxy-1-(2-methyl-1,3-thiazol-4-yl)propan-1-one?
The IUPAC name of 2-hydroxy-1-(2-methyl-1,3-thiazol-4-yl)propan-1-one (CID 130906323) is 2-hydroxy-1-(2-methyl-1,3-thiazol-4-yl)propan-1-one.
What is the SMILES notation for 2-hydroxy-1-(2-methyl-1,3-thiazol-4-yl)propan-1-one?
The canonical SMILES for 2-hydroxy-1-(2-methyl-1,3-thiazol-4-yl)propan-1-one is Cc1nc(C(=O)C(C)O)cs1.
What is the InChIKey of 2-hydroxy-1-(2-methyl-1,3-thiazol-4-yl)propan-1-one?
The InChIKey is AFIJVSZDGYGLPL-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H9NO2S/c1-4(9)7(10)6-3-11-5(2)8-6/h3-4,9H,1-2H3.
What are the key properties of 2-hydroxy-1-(2-methyl-1,3-thiazol-4-yl)propan-1-one?
2-hydroxy-1-(2-methyl-1,3-thiazol-4-yl)propan-1-one has a molecular weight of 171.22 g/mol, XLogP of 1.02, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-hydroxy-1-(2-methyl-1,3-thiazol-4-yl)propan-1-one is sourced from PubChem (CID 130906323), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).