C10H11N5OS — CID 66374374
2-(1-aminoethyl)-N,N-bis(cyanomethyl)-1,3-thiazole-4-carboxamide (PubChem CID 66374374) has the molecular formula C10H11N5OS and a molecular weight of 249.30 g/mol. Its IUPAC name is 2-(1-aminoethyl)-N,N-bis(cyanomethyl)-1,3-thiazole-4-carboxamide.
| Compound Name | 2-(1-aminoethyl)-N,N-bis(cyanomethyl)-1,3-thiazole-4-carboxamide |
|---|---|
| PubChem CID | 66374374 |
| Molecular Formula | C10H11N5OS |
| Molecular Weight | 249.30 g/mol |
| Exact Mass | 249.07 |
| IUPAC Name | 2-(1-aminoethyl)-N,N-bis(cyanomethyl)-1,3-thiazole-4-carboxamide |
| SMILES | CC(N)c1nc(C(=O)N(CC#N)CC#N)cs1 |
| InChI | InChI=1S/C10H11N5OS/c1-7(13)9-14-8(6-17-9)10(16)15(4-2-11)5-3-12/h6-7H,4-5,13H2,1H3 |
| InChIKey | JQXQNSANLXSTBN-UHFFFAOYSA-N |
| XLogP | 0.65 |
| TPSA | 106.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.30 |
| LogP ≤ 5 | 0.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cyanamide', 'substructure': 'N/A'} |
|---|