About (2-methyl-1,3-thiazol-4-yl)-pyrimidin-5-ylmethanone
(2-methyl-1,3-thiazol-4-yl)-pyrimidin-5-ylmethanone (PubChem CID 105085451) has the molecular formula C9H7N3OS
and a molecular weight of 205.24 g/mol. Its IUPAC name is (2-methyl-1,3-thiazol-4-yl)-pyrimidin-5-ylmethanone.
Analyze (2-methyl-1,3-thiazol-4-yl)-pyrimidin-5-ylmethanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2-methyl-1,3-thiazol-4-yl)-pyrimidin-5-ylmethanone?
The IUPAC name of (2-methyl-1,3-thiazol-4-yl)-pyrimidin-5-ylmethanone (CID 105085451) is (2-methyl-1,3-thiazol-4-yl)-pyrimidin-5-ylmethanone.
What is the SMILES notation for (2-methyl-1,3-thiazol-4-yl)-pyrimidin-5-ylmethanone?
The canonical SMILES for (2-methyl-1,3-thiazol-4-yl)-pyrimidin-5-ylmethanone is Cc1nc(C(=O)c2cncnc2)cs1.
What is the InChIKey of (2-methyl-1,3-thiazol-4-yl)-pyrimidin-5-ylmethanone?
The InChIKey is ROZMHAXSKNTYOW-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H7N3OS/c1-6-12-8(4-14-6)9(13)7-2-10-5-11-3-7/h2-5H,1H3.
What are the key properties of (2-methyl-1,3-thiazol-4-yl)-pyrimidin-5-ylmethanone?
(2-methyl-1,3-thiazol-4-yl)-pyrimidin-5-ylmethanone has a molecular weight of 205.24 g/mol, XLogP of 1.47, 2 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (2-methyl-1,3-thiazol-4-yl)-pyrimidin-5-ylmethanone is sourced from PubChem (CID 105085451), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).