C11H8FNOS — CID 105079830
(3-fluorophenyl)-(2-methyl-1,3-thiazol-4-yl)methanone (PubChem CID 105079830) has the molecular formula C11H8FNOS and a molecular weight of 221.26 g/mol. Its IUPAC name is (3-fluorophenyl)-(2-methyl-1,3-thiazol-4-yl)methanone.
| Compound Name | (3-fluorophenyl)-(2-methyl-1,3-thiazol-4-yl)methanone |
|---|---|
| PubChem CID | 105079830 |
| Molecular Formula | C11H8FNOS |
| Molecular Weight | 221.26 g/mol |
| Exact Mass | 221.03 |
| IUPAC Name | (3-fluorophenyl)-(2-methyl-1,3-thiazol-4-yl)methanone |
| SMILES | Cc1nc(C(=O)c2cccc(F)c2)cs1 |
| InChI | InChI=1S/C11H8FNOS/c1-7-13-10(6-15-7)11(14)8-3-2-4-9(12)5-8/h2-6H,1H3 |
| InChIKey | HUNFIIHZZKGBOY-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 29.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.26 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |