C14H14FN3O2S — CID 16916129
2-[(3-fluorobenzoyl)amino]-N-propan-2-yl-1,3-thiazole-4-carboxamide (PubChem CID 16916129) has the molecular formula C14H14FN3O2S and a molecular weight of 307.35 g/mol. Its IUPAC name is 2-[(3-fluorobenzoyl)amino]-N-propan-2-yl-1,3-thiazole-4-carboxamide.
| Compound Name | 2-[(3-fluorobenzoyl)amino]-N-propan-2-yl-1,3-thiazole-4-carboxamide |
|---|---|
| PubChem CID | 16916129 |
| Molecular Formula | C14H14FN3O2S |
| Molecular Weight | 307.35 g/mol |
| Exact Mass | 307.08 |
| IUPAC Name | 2-[(3-fluorobenzoyl)amino]-N-propan-2-yl-1,3-thiazole-4-carboxamide |
| SMILES | CC(C)NC(=O)c1csc(NC(=O)c2cccc(F)c2)n1 |
| InChI | InChI=1S/C14H14FN3O2S/c1-8(2)16-13(20)11-7-21-14(17-11)18-12(19)9-4-3-5-10(15)6-9/h3-8H,1-2H3,(H,16,20)(H,17,18,19) |
| InChIKey | STONHLJIKASBBB-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 71.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.35 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |