C7H9FN2OS — CID 118603833
2-fluoro-N-propan-2-yl-1,3-thiazole-4-carboxamide (PubChem CID 118603833) has the molecular formula C7H9FN2OS and a molecular weight of 188.23 g/mol. Its IUPAC name is 2-fluoro-N-propan-2-yl-1,3-thiazole-4-carboxamide.
| Compound Name | 2-fluoro-N-propan-2-yl-1,3-thiazole-4-carboxamide |
|---|---|
| PubChem CID | 118603833 |
| Molecular Formula | C7H9FN2OS |
| Molecular Weight | 188.23 g/mol |
| Exact Mass | 188.04 |
| IUPAC Name | 2-fluoro-N-propan-2-yl-1,3-thiazole-4-carboxamide |
| SMILES | CC(C)NC(=O)c1csc(F)n1 |
| InChI | InChI=1S/C7H9FN2OS/c1-4(2)9-6(11)5-3-12-7(8)10-5/h3-4H,1-2H3,(H,9,11) |
| InChIKey | MXGXOXRAKKUMNL-UHFFFAOYSA-N |
| XLogP | 1.42 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 188.23 |
| LogP ≤ 5 | 1.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |