C10H7BrN2OS — CID 166910014
(6-bromo-2-pyridinyl)-(2-methyl-1,3-thiazol-4-yl)methanone (PubChem CID 166910014) has the molecular formula C10H7BrN2OS and a molecular weight of 283.15 g/mol. Its IUPAC name is (6-bromo-2-pyridinyl)-(2-methyl-1,3-thiazol-4-yl)methanone.
| Compound Name | (6-bromo-2-pyridinyl)-(2-methyl-1,3-thiazol-4-yl)methanone |
|---|---|
| PubChem CID | 166910014 |
| Molecular Formula | C10H7BrN2OS |
| Molecular Weight | 283.15 g/mol |
| Exact Mass | 281.95 |
| IUPAC Name | (6-bromo-2-pyridinyl)-(2-methyl-1,3-thiazol-4-yl)methanone |
| SMILES | Cc1nc(C(=O)c2cccc(Br)n2)cs1 |
| InChI | InChI=1S/C10H7BrN2OS/c1-6-12-8(5-15-6)10(14)7-3-2-4-9(11)13-7/h2-5H,1H3 |
| InChIKey | JQBRQZBRVWCSEI-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 42.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.15 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|