About (3-bromo-2,4-dimethoxyphenyl)-(2-methyl-1,3-thiazol-4-yl)methanone
(3-bromo-2,4-dimethoxyphenyl)-(2-methyl-1,3-thiazol-4-yl)methanone (PubChem CID 103524389) has the molecular formula C13H12BrNO3S
and a molecular weight of 342.21 g/mol. Its IUPAC name is (3-bromo-2,4-dimethoxyphenyl)-(2-methyl-1,3-thiazol-4-yl)methanone.
Molecular Properties
| Compound Name | (3-bromo-2,4-dimethoxyphenyl)-(2-methyl-1,3-thiazol-4-yl)methanone |
| PubChem CID | 103524389 |
| Molecular Formula | C13H12BrNO3S |
| Molecular Weight | 342.21 g/mol |
| Exact Mass | 340.97 |
| IUPAC Name | (3-bromo-2,4-dimethoxyphenyl)-(2-methyl-1,3-thiazol-4-yl)methanone |
| SMILES | COc1ccc(C(=O)c2csc(C)n2)c(OC)c1Br |
| InChI | InChI=1S/C13H12BrNO3S/c1-7-15-9(6-19-7)12(16)8-4-5-10(17-2)11(14)13(8)18-3/h4-6H,1-3H3 |
| InChIKey | RFBUNCJARPMTJC-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 48.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 342.21 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze (3-bromo-2,4-dimethoxyphenyl)-(2-methyl-1,3-thiazol-4-yl)methanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3-bromo-2,4-dimethoxyphenyl)-(2-methyl-1,3-thiazol-4-yl)methanone?
The IUPAC name of (3-bromo-2,4-dimethoxyphenyl)-(2-methyl-1,3-thiazol-4-yl)methanone (CID 103524389) is (3-bromo-2,4-dimethoxyphenyl)-(2-methyl-1,3-thiazol-4-yl)methanone.
What is the SMILES notation for (3-bromo-2,4-dimethoxyphenyl)-(2-methyl-1,3-thiazol-4-yl)methanone?
The canonical SMILES for (3-bromo-2,4-dimethoxyphenyl)-(2-methyl-1,3-thiazol-4-yl)methanone is COc1ccc(C(=O)c2csc(C)n2)c(OC)c1Br.
What is the InChIKey of (3-bromo-2,4-dimethoxyphenyl)-(2-methyl-1,3-thiazol-4-yl)methanone?
The InChIKey is RFBUNCJARPMTJC-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H12BrNO3S/c1-7-15-9(6-19-7)12(16)8-4-5-10(17-2)11(14)13(8)18-3/h4-6H,1-3H3.
What are the key properties of (3-bromo-2,4-dimethoxyphenyl)-(2-methyl-1,3-thiazol-4-yl)methanone?
(3-bromo-2,4-dimethoxyphenyl)-(2-methyl-1,3-thiazol-4-yl)methanone has a molecular weight of 342.21 g/mol, XLogP of 3.46, 4 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (3-bromo-2,4-dimethoxyphenyl)-(2-methyl-1,3-thiazol-4-yl)methanone is sourced from PubChem (CID 103524389), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).