C8H4N4O2 — CID 103513084
pyrazolo[1,5-a]pyrazine-3-carbonyl isocyanate (PubChem CID 103513084) has the molecular formula C8H4N4O2 and a molecular weight of 188.15 g/mol. Its IUPAC name is pyrazolo[1,5-a]pyrazine-3-carbonyl isocyanate.
| Compound Name | pyrazolo[1,5-a]pyrazine-3-carbonyl isocyanate |
|---|---|
| PubChem CID | 103513084 |
| Molecular Formula | C8H4N4O2 |
| Molecular Weight | 188.15 g/mol |
| Exact Mass | 188.03 |
| IUPAC Name | pyrazolo[1,5-a]pyrazine-3-carbonyl isocyanate |
| SMILES | O=C=NC(=O)c1cnn2ccncc12 |
| InChI | InChI=1S/C8H4N4O2/c13-5-10-8(14)6-3-11-12-2-1-9-4-7(6)12/h1-4H |
| InChIKey | ZVLFDCKWTGRIDU-UHFFFAOYSA-N |
| XLogP | 0.21 |
| TPSA | 76.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 188.15 |
| LogP ≤ 5 | 0.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isocyanate', 'substructure': 'N/A'} |
|---|