C8H8N6OS — CID 103123485
(pyrazolo[1,5-a]pyrazine-3-carbonylamino)thiourea (PubChem CID 103123485) has the molecular formula C8H8N6OS and a molecular weight of 236.26 g/mol. Its IUPAC name is (pyrazolo[1,5-a]pyrazine-3-carbonylamino)thiourea.
| Compound Name | (pyrazolo[1,5-a]pyrazine-3-carbonylamino)thiourea |
|---|---|
| PubChem CID | 103123485 |
| Molecular Formula | C8H8N6OS |
| Molecular Weight | 236.26 g/mol |
| Exact Mass | 236.05 |
| IUPAC Name | (pyrazolo[1,5-a]pyrazine-3-carbonylamino)thiourea |
| SMILES | NC(=S)NNC(=O)c1cnn2ccncc12 |
| InChI | InChI=1S/C8H8N6OS/c9-8(16)13-12-7(15)5-3-11-14-2-1-10-4-6(5)14/h1-4H,(H,12,15)(H3,9,13,16) |
| InChIKey | ASUQPHUEQLNQTR-UHFFFAOYSA-N |
| XLogP | -0.79 |
| TPSA | 97.34 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.26 |
| LogP ≤ 5 | -0.79 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|