C15H13N3O3 — CID 103124988
(3,5-dimethoxyphenyl)-pyrazolo[1,5-a]pyrazin-3-ylmethanone (PubChem CID 103124988) has the molecular formula C15H13N3O3 and a molecular weight of 283.29 g/mol. Its IUPAC name is (3,5-dimethoxyphenyl)-pyrazolo[1,5-a]pyrazin-3-ylmethanone.
| Compound Name | (3,5-dimethoxyphenyl)-pyrazolo[1,5-a]pyrazin-3-ylmethanone |
|---|---|
| PubChem CID | 103124988 |
| Molecular Formula | C15H13N3O3 |
| Molecular Weight | 283.29 g/mol |
| Exact Mass | 283.10 |
| IUPAC Name | (3,5-dimethoxyphenyl)-pyrazolo[1,5-a]pyrazin-3-ylmethanone |
| SMILES | COc1cc(OC)cc(C(=O)c2cnn3ccncc23)c1 |
| InChI | InChI=1S/C15H13N3O3/c1-20-11-5-10(6-12(7-11)21-2)15(19)13-8-17-18-4-3-16-9-14(13)18/h3-9H,1-2H3 |
| InChIKey | CTVRCLYMXDBIKX-UHFFFAOYSA-N |
| XLogP | 1.98 |
| TPSA | 65.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.29 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |