C12H10ClF6NO — CID 107490909
N-(2-chloroethyl)-N-(2,2-difluoroethyl)-2-fluoro-5-(trifluoromethyl)benzamide (PubChem CID 107490909) has the molecular formula C12H10ClF6NO and a molecular weight of 333.66 g/mol. Its IUPAC name is N-(2-chloroethyl)-N-(2,2-difluoroethyl)-2-fluoro-5-(trifluoromethyl)benzamide.
| Compound Name | N-(2-chloroethyl)-N-(2,2-difluoroethyl)-2-fluoro-5-(trifluoromethyl)benzamide |
|---|---|
| PubChem CID | 107490909 |
| Molecular Formula | C12H10ClF6NO |
| Molecular Weight | 333.66 g/mol |
| Exact Mass | 333.04 |
| IUPAC Name | N-(2-chloroethyl)-N-(2,2-difluoroethyl)-2-fluoro-5-(trifluoromethyl)benzamide |
| SMILES | O=C(c1cc(C(F)(F)F)ccc1F)N(CCCl)CC(F)F |
| InChI | InChI=1S/C12H10ClF6NO/c13-3-4-20(6-10(15)16)11(21)8-5-7(12(17,18)19)1-2-9(8)14/h1-2,5,10H,3-4,6H2 |
| InChIKey | FSDYAZVLBPNUSC-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.66 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|