C11H9ClF4N2O3 — CID 107490960
N-(2-chloroethyl)-N-(2,2-difluoroethyl)-4,5-difluoro-2-nitrobenzamide (PubChem CID 107490960) has the molecular formula C11H9ClF4N2O3 and a molecular weight of 328.65 g/mol. Its IUPAC name is N-(2-chloroethyl)-N-(2,2-difluoroethyl)-4,5-difluoro-2-nitrobenzamide.
| Compound Name | N-(2-chloroethyl)-N-(2,2-difluoroethyl)-4,5-difluoro-2-nitrobenzamide |
|---|---|
| PubChem CID | 107490960 |
| Molecular Formula | C11H9ClF4N2O3 |
| Molecular Weight | 328.65 g/mol |
| Exact Mass | 328.02 |
| IUPAC Name | N-(2-chloroethyl)-N-(2,2-difluoroethyl)-4,5-difluoro-2-nitrobenzamide |
| SMILES | O=C(c1cc(F)c(F)cc1[N+](=O)[O-])N(CCCl)CC(F)F |
| InChI | InChI=1S/C11H9ClF4N2O3/c12-1-2-17(5-10(15)16)11(19)6-3-7(13)8(14)4-9(6)18(20)21/h3-4,10H,1-2,5H2 |
| InChIKey | LTLUZMFLXWVFFP-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 63.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.65 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|