C13H15F4NO2 — CID 115771373
N-ethyl-2-fluoro-N-(3-hydroxypropyl)-5-(trifluoromethyl)benzamide (PubChem CID 115771373) has the molecular formula C13H15F4NO2 and a molecular weight of 293.26 g/mol. Its IUPAC name is N-ethyl-2-fluoro-N-(3-hydroxypropyl)-5-(trifluoromethyl)benzamide.
| Compound Name | N-ethyl-2-fluoro-N-(3-hydroxypropyl)-5-(trifluoromethyl)benzamide |
|---|---|
| PubChem CID | 115771373 |
| Molecular Formula | C13H15F4NO2 |
| Molecular Weight | 293.26 g/mol |
| Exact Mass | 293.10 |
| IUPAC Name | N-ethyl-2-fluoro-N-(3-hydroxypropyl)-5-(trifluoromethyl)benzamide |
| SMILES | CCN(CCCO)C(=O)c1cc(C(F)(F)F)ccc1F |
| InChI | InChI=1S/C13H15F4NO2/c1-2-18(6-3-7-19)12(20)10-8-9(13(15,16)17)4-5-11(10)14/h4-5,8,19H,2-3,6-7H2,1H3 |
| InChIKey | KUKXSMAKFHPVKU-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.26 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |