C16H25FN2OS — CID 107036899
N-[3-(diethylamino)propyl]-N-ethyl-2-fluoro-5-sulfanylbenzamide (PubChem CID 107036899) has the molecular formula C16H25FN2OS and a molecular weight of 312.45 g/mol. Its IUPAC name is N-[3-(diethylamino)propyl]-N-ethyl-2-fluoro-5-sulfanylbenzamide.
| Compound Name | N-[3-(diethylamino)propyl]-N-ethyl-2-fluoro-5-sulfanylbenzamide |
|---|---|
| PubChem CID | 107036899 |
| Molecular Formula | C16H25FN2OS |
| Molecular Weight | 312.45 g/mol |
| Exact Mass | 312.17 |
| IUPAC Name | N-[3-(diethylamino)propyl]-N-ethyl-2-fluoro-5-sulfanylbenzamide |
| SMILES | CCN(CC)CCCN(CC)C(=O)c1cc(S)ccc1F |
| InChI | InChI=1S/C16H25FN2OS/c1-4-18(5-2)10-7-11-19(6-3)16(20)14-12-13(21)8-9-15(14)17/h8-9,12,21H,4-7,10-11H2,1-3H3 |
| InChIKey | TZMLXUDOSXEJOY-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 23.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.45 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|