C11H8FN3OS — CID 107020704
N,N-bis(cyanomethyl)-2-fluoro-5-sulfanylbenzamide (PubChem CID 107020704) has the molecular formula C11H8FN3OS and a molecular weight of 249.27 g/mol. Its IUPAC name is N,N-bis(cyanomethyl)-2-fluoro-5-sulfanylbenzamide.
| Compound Name | N,N-bis(cyanomethyl)-2-fluoro-5-sulfanylbenzamide |
|---|---|
| PubChem CID | 107020704 |
| Molecular Formula | C11H8FN3OS |
| Molecular Weight | 249.27 g/mol |
| Exact Mass | 249.04 |
| IUPAC Name | N,N-bis(cyanomethyl)-2-fluoro-5-sulfanylbenzamide |
| SMILES | N#CCN(CC#N)C(=O)c1cc(S)ccc1F |
| InChI | InChI=1S/C11H8FN3OS/c12-10-2-1-8(17)7-9(10)11(16)15(5-3-13)6-4-14/h1-2,7,17H,5-6H2 |
| InChIKey | AUJJCYFVLNKKCA-UHFFFAOYSA-N |
| XLogP | 1.60 |
| TPSA | 67.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.27 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'cyanamide', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|