C12H12Cl2F3NO — CID 98658820
N,N-bis(2-chloroethyl)-4-(trifluoromethyl)benzamide (PubChem CID 98658820) has the molecular formula C12H12Cl2F3NO and a molecular weight of 314.13 g/mol. Its IUPAC name is N,N-bis(2-chloroethyl)-4-(trifluoromethyl)benzamide.
| Compound Name | N,N-bis(2-chloroethyl)-4-(trifluoromethyl)benzamide |
|---|---|
| PubChem CID | 98658820 |
| Molecular Formula | C12H12Cl2F3NO |
| Molecular Weight | 314.13 g/mol |
| Exact Mass | 313.02 |
| IUPAC Name | N,N-bis(2-chloroethyl)-4-(trifluoromethyl)benzamide |
| SMILES | O=C(c1ccc(C(F)(F)F)cc1)N(CCCl)CCCl |
| InChI | InChI=1S/C12H12Cl2F3NO/c13-5-7-18(8-6-14)11(19)9-1-3-10(4-2-9)12(15,16)17/h1-4H,5-8H2 |
| InChIKey | DTEFOASUACJIKI-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.13 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|