C22H27BrN4O2 — CID 51062841
2-[2-amino-3-(2-morpholin-4-ylethyl)benzimidazol-1-ium-1-yl]-1-(4-methylphenyl)ethanone bromide (PubChem CID 51062841) has the molecular formula C22H27BrN4O2 and a molecular weight of 459.39 g/mol. Its IUPAC name is 2-[2-amino-3-(2-morpholin-4-ylethyl)benzimidazol-1-ium-1-yl]-1-(4-methylphenyl)ethanone bromide.
| Compound Name | 2-[2-amino-3-(2-morpholin-4-ylethyl)benzimidazol-1-ium-1-yl]-1-(4-methylphenyl)ethanone bromide |
|---|---|
| PubChem CID | 51062841 |
| Molecular Formula | C22H27BrN4O2 |
| Molecular Weight | 459.39 g/mol |
| Exact Mass | 458.13 |
| IUPAC Name | 2-[2-amino-3-(2-morpholin-4-ylethyl)benzimidazol-1-ium-1-yl]-1-(4-methylphenyl)ethanone bromide |
| SMILES | Cc1ccc(C(=O)C[n+]2c(N)n(CCN3CCOCC3)c3ccccc32)cc1.[Br-] |
| InChI | InChI=1S/C22H26N4O2.BrH/c1-17-6-8-18(9-7-17)21(27)16-26-20-5-3-2-4-19(20)25(22(26)23)11-10-24-12-14-28-15-13-24;/h2-9,23H,10-16H2,1H3;1H |
| InChIKey | FNEJYLGQZLNGOT-UHFFFAOYSA-N |
| XLogP | -0.96 |
| TPSA | 64.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.39 |
| LogP ≤ 5 | -0.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|