C21H20N3O2+ — CID 4002263
2-[2-amino-3-[(4-methylphenyl)methyl]benzimidazol-3-ium-1-yl]-1-(furan-2-yl)ethanone (PubChem CID 4002263) has the molecular formula C21H20N3O2+ and a molecular weight of 346.41 g/mol. Its IUPAC name is 2-[2-amino-3-[(4-methylphenyl)methyl]benzimidazol-3-ium-1-yl]-1-(furan-2-yl)ethanone.
| Compound Name | 2-[2-amino-3-[(4-methylphenyl)methyl]benzimidazol-3-ium-1-yl]-1-(furan-2-yl)ethanone |
|---|---|
| PubChem CID | 4002263 |
| Molecular Formula | C21H20N3O2+ |
| Molecular Weight | 346.41 g/mol |
| Exact Mass | 346.16 |
| IUPAC Name | 2-[2-amino-3-[(4-methylphenyl)methyl]benzimidazol-3-ium-1-yl]-1-(furan-2-yl)ethanone |
| SMILES | Cc1ccc(C[n+]2c(N)n(CC(=O)c3ccco3)c3ccccc32)cc1 |
| InChI | InChI=1S/C21H19N3O2/c1-15-8-10-16(11-9-15)13-23-17-5-2-3-6-18(17)24(21(23)22)14-19(25)20-7-4-12-26-20/h2-12,22H,13-14H2,1H3/p+1 |
| InChIKey | POEIABZXNXGWKO-UHFFFAOYSA-O |
| XLogP | 3.34 |
| TPSA | 65.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.41 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|