C20H21N2OS+ — CID 21176265
2-(2-anilino-4-methyl-1,3-thiazol-3-ium-3-yl)-1-(2,4-dimethylphenyl)ethanone (PubChem CID 21176265) has the molecular formula C20H21N2OS+ and a molecular weight of 337.47 g/mol. Its IUPAC name is 2-(2-anilino-4-methyl-1,3-thiazol-3-ium-3-yl)-1-(2,4-dimethylphenyl)ethanone.
| Compound Name | 2-(2-anilino-4-methyl-1,3-thiazol-3-ium-3-yl)-1-(2,4-dimethylphenyl)ethanone |
|---|---|
| PubChem CID | 21176265 |
| Molecular Formula | C20H21N2OS+ |
| Molecular Weight | 337.47 g/mol |
| Exact Mass | 337.14 |
| IUPAC Name | 2-(2-anilino-4-methyl-1,3-thiazol-3-ium-3-yl)-1-(2,4-dimethylphenyl)ethanone |
| SMILES | Cc1ccc(C(=O)C[n+]2c(C)csc2Nc2ccccc2)c(C)c1 |
| InChI | InChI=1S/C20H20N2OS/c1-14-9-10-18(15(2)11-14)19(23)12-22-16(3)13-24-20(22)21-17-7-5-4-6-8-17/h4-11,13H,12H2,1-3H3/p+1 |
| InChIKey | AIUPEBMFTDZZOF-UHFFFAOYSA-O |
| XLogP | 4.59 |
| TPSA | 32.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.47 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|