C16H18NO+ — CID 4150720
1-(2,4-dimethylphenyl)-2-(2-methylpyridin-1-ium-1-yl)ethanone (PubChem CID 4150720) has the molecular formula C16H18NO+ and a molecular weight of 240.33 g/mol. Its IUPAC name is 1-(2,4-dimethylphenyl)-2-(2-methylpyridin-1-ium-1-yl)ethanone.
| Compound Name | 1-(2,4-dimethylphenyl)-2-(2-methylpyridin-1-ium-1-yl)ethanone |
|---|---|
| PubChem CID | 4150720 |
| Molecular Formula | C16H18NO+ |
| Molecular Weight | 240.33 g/mol |
| Exact Mass | 240.14 |
| IUPAC Name | 1-(2,4-dimethylphenyl)-2-(2-methylpyridin-1-ium-1-yl)ethanone |
| SMILES | Cc1ccc(C(=O)C[n+]2ccccc2C)c(C)c1 |
| InChI | InChI=1S/C16H18NO/c1-12-7-8-15(13(2)10-12)16(18)11-17-9-5-4-6-14(17)3/h4-10H,11H2,1-3H3/q+1 |
| InChIKey | YNMPRFHHOUESDN-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 20.95 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.33 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|