C18H20BrNO — CID 45112216
2-(2-methylpyridin-1-ium-1-yl)-1-(5,6,7,8-tetrahydronaphthalen-2-yl)ethanone bromide (PubChem CID 45112216) has the molecular formula C18H20BrNO and a molecular weight of 346.27 g/mol. Its IUPAC name is 2-(2-methylpyridin-1-ium-1-yl)-1-(5,6,7,8-tetrahydronaphthalen-2-yl)ethanone bromide.
| Compound Name | 2-(2-methylpyridin-1-ium-1-yl)-1-(5,6,7,8-tetrahydronaphthalen-2-yl)ethanone bromide |
|---|---|
| PubChem CID | 45112216 |
| Molecular Formula | C18H20BrNO |
| Molecular Weight | 346.27 g/mol |
| Exact Mass | 345.07 |
| IUPAC Name | 2-(2-methylpyridin-1-ium-1-yl)-1-(5,6,7,8-tetrahydronaphthalen-2-yl)ethanone bromide |
| SMILES | Cc1cccc[n+]1CC(=O)c1ccc2c(c1)CCCC2.[Br-] |
| InChI | InChI=1S/C18H20NO.BrH/c1-14-6-4-5-11-19(14)13-18(20)17-10-9-15-7-2-3-8-16(15)12-17;/h4-6,9-12H,2-3,7-8,13H2,1H3;1H/q+1;/p-1 |
| InChIKey | VMFYGCBFGKTSBS-UHFFFAOYSA-M |
| XLogP | 0.05 |
| TPSA | 20.95 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.27 |
| LogP ≤ 5 | 0.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|