C33H27Br2NOS — CID 13415465
1-(4-bromophenyl)-2-[1-[(4-methylphenyl)methyl]-4,6-diphenylpyridin-1-ium-2-yl]sulfanylethanone bromide (PubChem CID 13415465) has the molecular formula C33H27Br2NOS and a molecular weight of 645.46 g/mol. Its IUPAC name is 1-(4-bromophenyl)-2-[1-[(4-methylphenyl)methyl]-4,6-diphenylpyridin-1-ium-2-yl]sulfanylethanone bromide.
| Compound Name | 1-(4-bromophenyl)-2-[1-[(4-methylphenyl)methyl]-4,6-diphenylpyridin-1-ium-2-yl]sulfanylethanone bromide |
|---|---|
| PubChem CID | 13415465 |
| Molecular Formula | C33H27Br2NOS |
| Molecular Weight | 645.46 g/mol |
| Exact Mass | 643.02 |
| IUPAC Name | 1-(4-bromophenyl)-2-[1-[(4-methylphenyl)methyl]-4,6-diphenylpyridin-1-ium-2-yl]sulfanylethanone bromide |
| SMILES | Cc1ccc(C[n+]2c(SCC(=O)c3ccc(Br)cc3)cc(-c3ccccc3)cc2-c2ccccc2)cc1.[Br-] |
| InChI | InChI=1S/C33H27BrNOS.BrH/c1-24-12-14-25(15-13-24)22-35-31(27-10-6-3-7-11-27)20-29(26-8-4-2-5-9-26)21-33(35)37-23-32(36)28-16-18-30(34)19-17-28;/h2-21H,22-23H2,1H3;1H/q+1;/p-1 |
| InChIKey | HSGIRODQWSESFD-UHFFFAOYSA-M |
| XLogP | 5.41 |
| TPSA | 20.95 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 645.46 |
| LogP ≤ 5 | 5.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|