C33H27ClNOS+ — CID 135051256
2-[1-[(4-chlorophenyl)methyl]-4,6-diphenylpyridin-1-ium-2-yl]sulfanyl-1-(4-methylphenyl)ethanone (PubChem CID 135051256) has the molecular formula C33H27ClNOS+ and a molecular weight of 521.11 g/mol. Its IUPAC name is 2-[1-[(4-chlorophenyl)methyl]-4,6-diphenylpyridin-1-ium-2-yl]sulfanyl-1-(4-methylphenyl)ethanone.
| Compound Name | 2-[1-[(4-chlorophenyl)methyl]-4,6-diphenylpyridin-1-ium-2-yl]sulfanyl-1-(4-methylphenyl)ethanone |
|---|---|
| PubChem CID | 135051256 |
| Molecular Formula | C33H27ClNOS+ |
| Molecular Weight | 521.11 g/mol |
| Exact Mass | 520.15 |
| IUPAC Name | 2-[1-[(4-chlorophenyl)methyl]-4,6-diphenylpyridin-1-ium-2-yl]sulfanyl-1-(4-methylphenyl)ethanone |
| SMILES | Cc1ccc(C(=O)CSc2cc(-c3ccccc3)cc(-c3ccccc3)[n+]2Cc2ccc(Cl)cc2)cc1 |
| InChI | InChI=1S/C33H27ClNOS/c1-24-12-16-28(17-13-24)32(36)23-37-33-21-29(26-8-4-2-5-9-26)20-31(27-10-6-3-7-11-27)35(33)22-25-14-18-30(34)19-15-25/h2-21H,22-23H2,1H3/q+1 |
| InChIKey | DAGJDIZLEGSMPW-UHFFFAOYSA-N |
| XLogP | 8.29 |
| TPSA | 20.95 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 521.11 |
| LogP ≤ 5 | 8.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|