C27H24NO4+ — CID 3839323
1-benzyl-2,6-bis(4-methoxyphenyl)pyridin-1-ium-4-carboxylic acid (PubChem CID 3839323) has the molecular formula C27H24NO4+ and a molecular weight of 426.49 g/mol. Its IUPAC name is 1-benzyl-2,6-bis(4-methoxyphenyl)pyridin-1-ium-4-carboxylic acid.
| Compound Name | 1-benzyl-2,6-bis(4-methoxyphenyl)pyridin-1-ium-4-carboxylic acid |
|---|---|
| PubChem CID | 3839323 |
| Molecular Formula | C27H24NO4+ |
| Molecular Weight | 426.49 g/mol |
| Exact Mass | 426.17 |
| IUPAC Name | 1-benzyl-2,6-bis(4-methoxyphenyl)pyridin-1-ium-4-carboxylic acid |
| SMILES | COc1ccc(-c2cc(C(=O)O)cc(-c3ccc(OC)cc3)[n+]2Cc2ccccc2)cc1 |
| InChI | InChI=1S/C27H23NO4/c1-31-23-12-8-20(9-13-23)25-16-22(27(29)30)17-26(21-10-14-24(32-2)15-11-21)28(25)18-19-6-4-3-5-7-19/h3-17H,18H2,1-2H3/p+1 |
| InChIKey | MDKMKSDMWFNRQS-UHFFFAOYSA-O |
| XLogP | 5.07 |
| TPSA | 59.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.49 |
| LogP ≤ 5 | 5.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|