C37H32N+ — CID 102393067
1-benzyl-2,4-diphenyl-6-(4,6,8-trimethylazulen-1-yl)pyridin-1-ium (PubChem CID 102393067) has the molecular formula C37H32N+ and a molecular weight of 490.67 g/mol. Its IUPAC name is 1-benzyl-2,4-diphenyl-6-(4,6,8-trimethylazulen-1-yl)pyridin-1-ium.
| Compound Name | 1-benzyl-2,4-diphenyl-6-(4,6,8-trimethylazulen-1-yl)pyridin-1-ium |
|---|---|
| PubChem CID | 102393067 |
| Molecular Formula | C37H32N+ |
| Molecular Weight | 490.67 g/mol |
| Exact Mass | 490.25 |
| IUPAC Name | 1-benzyl-2,4-diphenyl-6-(4,6,8-trimethylazulen-1-yl)pyridin-1-ium |
| SMILES | Cc1cc(C)c2ccc(-c3cc(-c4ccccc4)cc(-c4ccccc4)[n+]3Cc3ccccc3)c-2c(C)c1 |
| InChI | InChI=1S/C37H32N/c1-26-21-27(2)33-19-20-34(37(33)28(3)22-26)36-24-32(30-15-9-5-10-16-30)23-35(31-17-11-6-12-18-31)38(36)25-29-13-7-4-8-14-29/h4-24H,25H2,1-3H3/q+1 |
| InChIKey | LEHQONNGXAVSOT-UHFFFAOYSA-N |
| XLogP | 9.05 |
| TPSA | 3.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 5 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.67 |
| LogP ≤ 5 | 9.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|