C30H23BClF4N — CID 12846148
1-benzyl-4-(3-chlorophenyl)-2,6-diphenylpyridin-1-ium tetrafluoroborate (PubChem CID 12846148) has the molecular formula C30H23BClF4N and a molecular weight of 519.78 g/mol. Its IUPAC name is 1-benzyl-4-(3-chlorophenyl)-2,6-diphenylpyridin-1-ium tetrafluoroborate.
| Compound Name | 1-benzyl-4-(3-chlorophenyl)-2,6-diphenylpyridin-1-ium tetrafluoroborate |
|---|---|
| PubChem CID | 12846148 |
| Molecular Formula | C30H23BClF4N |
| Molecular Weight | 519.78 g/mol |
| Exact Mass | 519.15 |
| IUPAC Name | 1-benzyl-4-(3-chlorophenyl)-2,6-diphenylpyridin-1-ium tetrafluoroborate |
| SMILES | Clc1cccc(-c2cc(-c3ccccc3)[n+](Cc3ccccc3)c(-c3ccccc3)c2)c1.F[B-](F)(F)F |
| InChI | InChI=1S/C30H23ClN.BF4/c31-28-18-10-17-26(19-28)27-20-29(24-13-6-2-7-14-24)32(22-23-11-4-1-5-12-23)30(21-27)25-15-8-3-9-16-25;2-1(3,4)5/h1-21H,22H2;/q+1;-1 |
| InChIKey | UPRDWPXBGQBPRL-UHFFFAOYSA-N |
| XLogP | 8.98 |
| TPSA | 3.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 519.78 |
| LogP ≤ 5 | 8.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|