C31H26BF4NS — CID 13113563
2,4,6-triphenyl-1-(2-phenylsulfanylethyl)pyridin-1-ium tetrafluoroborate (PubChem CID 13113563) has the molecular formula C31H26BF4NS and a molecular weight of 531.43 g/mol. Its IUPAC name is 2,4,6-triphenyl-1-(2-phenylsulfanylethyl)pyridin-1-ium tetrafluoroborate.
| Compound Name | 2,4,6-triphenyl-1-(2-phenylsulfanylethyl)pyridin-1-ium tetrafluoroborate |
|---|---|
| PubChem CID | 13113563 |
| Molecular Formula | C31H26BF4NS |
| Molecular Weight | 531.43 g/mol |
| Exact Mass | 531.18 |
| IUPAC Name | 2,4,6-triphenyl-1-(2-phenylsulfanylethyl)pyridin-1-ium tetrafluoroborate |
| SMILES | F[B-](F)(F)F.c1ccc(SCC[n+]2c(-c3ccccc3)cc(-c3ccccc3)cc2-c2ccccc2)cc1 |
| InChI | InChI=1S/C31H26NS.BF4/c1-5-13-25(14-6-1)28-23-30(26-15-7-2-8-16-26)32(21-22-33-29-19-11-4-12-20-29)31(24-28)27-17-9-3-10-18-27;2-1(3,4)5/h1-20,23-24H,21-22H2;/q+1;-1 |
| InChIKey | ZHZGGWIJRYKWDE-UHFFFAOYSA-N |
| XLogP | 9.07 |
| TPSA | 3.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 531.43 |
| LogP ≤ 5 | 9.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|